| Product Name | Suramin sodium |
|---|---|
| Chinese alias | Suramine sodium salt |
| CAS | 129-46-4 |
| Formula | C51H40N6O23S6.6Na |
| MW | 1429.17 |
| Appearance | 白色 |
| MDL | MFCD00210217 |
| Storage condition | 0-6°C |
Product Center
MF:
C51H40N6O23S6.6Na
MW:
1429.17
Characters:白色
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB01255 | yunbang | 25mg | 98% | $130.00 | Visible after login | Inquiry | ||
| YB01255 | yunbang | 50mg | 98% | $195.00 | Visible after login | Inquiry | ||
| YB01255 | yunbang | 100mg | 98% | $293.33 | Visible after login | Inquiry | ||
| YB01255 | yunbang | 250mg | 98% | $441.67 | Visible after login | Inquiry | ||
| YB01255 | yunbang | 1g | 98% | $1225.00 | Visible after login | Inquiry |
| Product Name | Suramin sodium |
|---|---|
| Chinese alias | Suramine sodium salt |
| CAS | 129-46-4 |
| Formula | C51H40N6O23S6.6Na |
| MW | 1429.17 |
| Appearance | 白色 |
| MDL | MFCD00210217 |
| Storage condition | 0-6°C |
| Symbol | N/A |
|---|---|
| Safe Property | 22-24/25 |
| Hazard Category Code | R22:Harmful if swallowed. R36/38:Irritating to eyes and skin . |
| Chinese alias | Suramine sodium salt |
|---|---|
| CAS | 129-46-4 |
| Formula | C51H40N6O23S6.6Na |
| MW | 1429.17 |
| Appearance | 白色 |
| MDL | MFCD00210217 |
| Safe Property | 22-24/25 |
| Hazard Category Code | R22:Harmful if swallowed. R36/38:Irritating to eyes and skin . |
| Water Solubility | H2O: 10 mg/mL |
| Storage | 0-6°C |
| Smiles | N(C1C2C(S(O)(=O)=O)=CC(S(O)(=O)=O)=CC=2C(=CC=1)S(O)(=O)=O)C(C1C=CC(C)=C(NC(C2C=CC=C(NC(=O)NC3C=CC=C(C(=O)NC4C(C)=CC=C(C(=O)NC5C6C(S(O)(=O)=O)=CC(S(O)(=O)=O)=CC=6C(=CC=5)S(O)(=O)=O)C=4)C=3)C=2)=O)C=1)=O.[Na] |^1:86| |
| InchiKey | HWRBYSXGEWIANS-UHFFFAOYSA-N |