| Product Name | Dihydrogen hexahydroxyplatinate |
|---|---|
| Chinese alias | Platinic acid |
| CAS | 51850-20-5 |
| Formula | H6O6Pt.2H |
| MW | 299.14 |
| Appearance | powder and chunks |
| MDL | MFCD00058744 |
| Boiling point | 100°C at 760 mmHg |
Product Center
MF:
H6O6Pt.2H
MW:
299.14
Characters:powder and chunks
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB02062 | yunbang | 100mg | 98% | $18.33 | Visible after login | Inquiry | ||
| YB02062 | yunbang | 250mg | 98% | $28.33 | Visible after login | Inquiry | ||
| YB02062 | yunbang | 1g | 98% | $91.67 | Visible after login | Inquiry | ||
| YB02062 | yunbang | 5g | 98% | $440.00 | Visible after login | Inquiry |
| Product Name | Dihydrogen hexahydroxyplatinate |
|---|---|
| Chinese alias | Platinic acid |
| CAS | 51850-20-5 |
| Formula | H6O6Pt.2H |
| MW | 299.14 |
| Appearance | powder and chunks |
| MDL | MFCD00058744 |
| Boiling point | 100°C at 760 mmHg |
| Symbol | N/A |
|---|---|
| Safe Property | S22-26-36/37/39-38-37/39-28A |
| Hazard Category Code | R20-36/37/38-43 |
| Chinese alias | Platinic acid |
|---|---|
| CAS | 51850-20-5 |
| Formula | H6O6Pt.2H |
| MW | 299.14 |
| Appearance | powder and chunks |
| MDL | MFCD00058744 |
| Boiling point | 100°C at 760 mmHg |
| Safe Property | S22-26-36/37/39-38-37/39-28A |
| Hazard Category Code | R20-36/37/38-43 |
| Water Solubility | H2O: slightly soluble(lit.)aqueous acid: slightly soluble(lit.) |
| Smiles | [Pt+4]([OH-])([OH-])([OH-])([OH-])([OH-])[OH-].[H+] |
| InchiKey | ILXDKMTYQJUXAB-UHFFFAOYSA-I |