Product Name | α-D-Mannopyranose |
---|---|
CAS | 7296-15-3 |
Formula | C6H12O6 |
MW | 180.16 |
Melting point | 133 °C(lit.) |
Boiling point | 410.8±45.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | α-D-Mannopyranose |
---|---|
CAS | 7296-15-3 |
Formula | C6H12O6 |
MW | 180.16 |
Melting point | 133 °C(lit.) |
Boiling point | 410.8±45.0 °C(lit.) |
CAS | 7296-15-3 |
---|---|
Formula | C6H12O6 |
MW | 180.16 |
Melting point | 133 °C(lit.) |
Boiling point | 410.8±45.0 °C(lit.) |
特性 | * |
Smiles | C([CH]1[CH]([CH]([CH]([CH](O1)O)O)O)O)O |
InchiKey | WQZGKKKJIJFFOK-UHFFFAOYSA-N |