Product Name | 5-O-Benzoyl-1,2-O-isopropylidene-α-D-allofuranose |
---|---|
CAS | 60480-35-5 |
Formula | C16H20O7 |
MW | 324.33 |
Boiling point | 502.1±50.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 5-O-Benzoyl-1,2-O-isopropylidene-α-D-allofuranose |
---|---|
CAS | 60480-35-5 |
Formula | C16H20O7 |
MW | 324.33 |
Boiling point | 502.1±50.0 °C(lit.) |
CAS | 60480-35-5 |
---|---|
Formula | C16H20O7 |
MW | 324.33 |
Boiling point | 502.1±50.0 °C(lit.) |
特性 | * |
Smiles | [C]12([H])OC(C)(C)OC1O[C]([H])([CH](CO)O)[CH]2OC(C1=CC=CC=C1)=O |
InchiKey | FVMGHHSPTSHJCW-UHFFFAOYSA-N |