Product Name | 1,2:5,6-Di-O-isopropylidene-3-O-tosyl-α-D-gulofuranose |
---|---|
CAS | 19131-06-7 |
Formula | C19 H26 O8 S |
MW | 414.47 |
Appearance | white crystalline solid |
MDL | MFCD09840476 |
Boiling point | 511.3±50.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 1,2:5,6-Di-O-isopropylidene-3-O-tosyl-α-D-gulofuranose |
---|---|
CAS | 19131-06-7 |
Formula | C19 H26 O8 S |
MW | 414.47 |
Appearance | white crystalline solid |
MDL | MFCD09840476 |
Boiling point | 511.3±50.0 °C(lit.) |
CAS | 19131-06-7 |
---|---|
Formula | C19 H26 O8 S |
MW | 414.47 |
Appearance | white crystalline solid |
MDL | MFCD09840476 |
Boiling point | 511.3±50.0 °C(lit.) |
特性 | * |
Smiles | CC1=CC=C(C=C1)S(=O)(=O)O[CH]2[CH](O[CH]3[CH]2OC(O3)(C)C)[CH]4COC(O4)(C)C |
InchiKey | FOVFLADZRUACHW-UHFFFAOYSA-N |