Product Name | Methyl-2,3,4-tri-O-benzyl-β-D-glucopyranoside |
---|---|
CAS | 4356-80-3 |
Formula | C28 H32 O6 |
MW | 464.55 |
Melting point | 90-91 °C |
Boiling point | 593.0±50.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | Methyl-2,3,4-tri-O-benzyl-β-D-glucopyranoside |
---|---|
CAS | 4356-80-3 |
Formula | C28 H32 O6 |
MW | 464.55 |
Melting point | 90-91 °C |
Boiling point | 593.0±50.0 °C(Predicted) |
CAS | 4356-80-3 |
---|---|
Formula | C28 H32 O6 |
MW | 464.55 |
Melting point | 90-91 °C |
Boiling point | 593.0±50.0 °C(Predicted) |
Smiles | O([C@@H]1[C@H]([C@H](OC)O[C@H](CO)[C@H]1OCC1C=CC=CC=1)OCC1C=CC=CC=1)CC1C=CC=CC=1 |&1:1,2,3,7,10,r| |
InchiKey | MOKYEUQDXDKNDX-NZFGTWGTNA-N |