Product Name | Methyl-6-O-tosyl-α-D-galactopyranoside |
---|---|
CAS | 34698-19-6 |
Formula | C14 H20 O8 S |
MW | 348.37 |
MDL | MFCD30176667 |
Melting point | 170 °C |
Boiling point | 550.2±50.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | Methyl-6-O-tosyl-α-D-galactopyranoside |
---|---|
CAS | 34698-19-6 |
Formula | C14 H20 O8 S |
MW | 348.37 |
MDL | MFCD30176667 |
Melting point | 170 °C |
Boiling point | 550.2±50.0 °C(Predicted) |
CAS | 34698-19-6 |
---|---|
Formula | C14 H20 O8 S |
MW | 348.37 |
MDL | MFCD30176667 |
Melting point | 170 °C |
Boiling point | 550.2±50.0 °C(Predicted) |
Smiles | C1(S(OC[C@H]2O[C@H](OC)[C@H](O)[C@@H](O)[C@H]2O)(=O)=O)=CC=C(C)C=C1 |
InchiKey | DBMMVDKCWRGJEG-HTOAHKCRSA-N |