Product Name | Methyl-2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside |
---|---|
CAS | 5019-23-8 |
Formula | C15 H22 O10 |
MW | 362.33 |
Melting point | 94 °C |
Boiling point | 407.3±45.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | Methyl-2,3,4,6-tetra-O-acetyl-β-D-galactopyranoside |
---|---|
CAS | 5019-23-8 |
Formula | C15 H22 O10 |
MW | 362.33 |
Melting point | 94 °C |
Boiling point | 407.3±45.0 °C(Predicted) |
CAS | 5019-23-8 |
---|---|
Formula | C15 H22 O10 |
MW | 362.33 |
Melting point | 94 °C |
Boiling point | 407.3±45.0 °C(Predicted) |
Smiles | O([C@@H]1[C@H]([C@H](OC)O[C@H](COC(=O)C)[C@@H]1OC(=O)C)OC(=O)C)C(=O)C |&1:1,2,3,7,13,r| |
InchiKey | UYWUMFGDPBMNCA-YWLSEJSHNA-N |