Product Name | Methyl-3,4-Oisopropylidene-β-D-galactopyranoside |
---|---|
CAS | 14897-47-3 |
Formula | C10 H18 O6 |
MW | 234.25 |
MDL | MFCD08703823 |
Melting point | 137-138 °C(Solv: ethyl acetate (141-78-6)) |
Boiling point | 382.9±42.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | Methyl-3,4-Oisopropylidene-β-D-galactopyranoside |
---|---|
CAS | 14897-47-3 |
Formula | C10 H18 O6 |
MW | 234.25 |
MDL | MFCD08703823 |
Melting point | 137-138 °C(Solv: ethyl acetate (141-78-6)) |
Boiling point | 382.9±42.0 °C(Predicted) |
CAS | 14897-47-3 |
---|---|
Formula | C10 H18 O6 |
MW | 234.25 |
MDL | MFCD08703823 |
Melting point | 137-138 °C(Solv: ethyl acetate (141-78-6)) |
Boiling point | 382.9±42.0 °C(Predicted) |
Smiles | C([C@H]1O[C@@H](OC)[C@H](O)[C@@]2([H])OC(C)(C)O[C@@]12[H])O |&1:1,3,6,8,15,r| |
InchiKey | NZEWRADQNQAPED-CNYAZSFUNA-N |