Product Name | (2R,3R,4S,5S,6S)-2-(Hydroxymethyl)-6-methoxytetrahydro-2H-pyran-3,4,5-triyl triacetate |
---|---|
CAS | 7468-47-5 |
Formula | C13 H20 O9 |
MW | 320.293 |
MDL | MFCD19980988 |
Melting point | 98 °C |
Boiling point | 389.6±42.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | (2R,3R,4S,5S,6S)-2-(Hydroxymethyl)-6-methoxytetrahydro-2H-pyran-3,4,5-triyl triacetate |
---|---|
CAS | 7468-47-5 |
Formula | C13 H20 O9 |
MW | 320.293 |
MDL | MFCD19980988 |
Melting point | 98 °C |
Boiling point | 389.6±42.0 °C(Predicted) |
CAS | 7468-47-5 |
---|---|
Formula | C13 H20 O9 |
MW | 320.293 |
MDL | MFCD19980988 |
Melting point | 98 °C |
Boiling point | 389.6±42.0 °C(Predicted) |
Smiles | C(OC1C(OC(C)=O)C(OC)OC(CO)C1OC(C)=O)(=O)C |
InchiKey | OBVFJYUDIWPVKD-UHFFFAOYSA-N |