Product Name | Methyl-2,3,4-tri-O-acetyl-β-L-D-fucopyranoside |
---|---|
CAS | 24332-97-6 |
Formula | C13 H20 O8 |
MW | 304.29 |
Melting point | 74 °C(Solv: ethanol, 25% (64-17-5)) |
Boiling point | 341.4±42.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | Methyl-2,3,4-tri-O-acetyl-β-L-D-fucopyranoside |
---|---|
CAS | 24332-97-6 |
Formula | C13 H20 O8 |
MW | 304.29 |
Melting point | 74 °C(Solv: ethanol, 25% (64-17-5)) |
Boiling point | 341.4±42.0 °C(Predicted) |
CAS | 24332-97-6 |
---|---|
Formula | C13 H20 O8 |
MW | 304.29 |
Melting point | 74 °C(Solv: ethanol, 25% (64-17-5)) |
Boiling point | 341.4±42.0 °C(Predicted) |
Smiles | O([C@@H]1[C@@H]([C@H](C)O[C@H](OC)[C@H]1OC(=O)C)OC(=O)C)C(=O)C |&1:1,2,3,6,9,r| |
InchiKey | RTVWBDNQHISFHI-LTGHJBNKNA-N |