Product Name | Propargyl-α-D-glucopyranoside |
---|---|
CAS | 151168-60-4 |
Formula | C9 H14 O6 |
MW | 218.20 |
MDL | MFCD31916267 |
Boiling point | 452.5±45.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | Propargyl-α-D-glucopyranoside |
---|---|
CAS | 151168-60-4 |
Formula | C9 H14 O6 |
MW | 218.20 |
MDL | MFCD31916267 |
Boiling point | 452.5±45.0 °C(Predicted) |
CAS | 151168-60-4 |
---|---|
Formula | C9 H14 O6 |
MW | 218.20 |
MDL | MFCD31916267 |
Boiling point | 452.5±45.0 °C(Predicted) |
Smiles | O(CC#C)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
InchiKey | DSKUDOWHGLWCBQ-ZEBDFXRSSA-N |