Product Name | Allyl-β-L-arabinopyranoside |
---|---|
CAS | 134149-43-2 |
Formula | C8 H14 O5 |
MW | 190.19 |
Melting point | 118-120 °C |
Boiling point | 345.9±42.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | Allyl-β-L-arabinopyranoside |
---|---|
CAS | 134149-43-2 |
Formula | C8 H14 O5 |
MW | 190.19 |
Melting point | 118-120 °C |
Boiling point | 345.9±42.0 °C(Predicted) |
CAS | 134149-43-2 |
---|---|
Formula | C8 H14 O5 |
MW | 190.19 |
Melting point | 118-120 °C |
Boiling point | 345.9±42.0 °C(Predicted) |
Smiles | O([C@H]1OC[C@H](O)[C@H](O)[C@H]1O)CC=C |&1:1,4,6,8,r| |
InchiKey | SQPCRAFFYUVIQE-GJPWOAQLNA-N |