Product Name | Benzyl-2,3,4,6-tetra-O-acetyl-1-thio-α-D-mannopyranoside |
---|---|
CAS | 74590-46-8 |
Formula | C21 H26 O9 S |
MW | 454.49 |
Melting point | 139-140 °C |
Boiling point | 526.0±50.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | Benzyl-2,3,4,6-tetra-O-acetyl-1-thio-α-D-mannopyranoside |
---|---|
CAS | 74590-46-8 |
Formula | C21 H26 O9 S |
MW | 454.49 |
Melting point | 139-140 °C |
Boiling point | 526.0±50.0 °C(Predicted) |
CAS | 74590-46-8 |
---|---|
Formula | C21 H26 O9 S |
MW | 454.49 |
Melting point | 139-140 °C |
Boiling point | 526.0±50.0 °C(Predicted) |
Smiles | O([C@H]1[C@@H]([C@@H](COC(=O)C)O[C@H](SCC2C=CC=CC=2)[C@H]1OC(=O)C)OC(=O)C)C(=O)C |&1:1,2,3,10,19,r| |
InchiKey | UVVCYZREUQWNFB-WFCPIQDQNA-N |