Product Name | Benzyl-1-thio-α-D-mannopyranoside |
---|---|
CAS | 74590-47-9 |
Formula | C13 H18 O5 S |
MW | 286.34 |
Boiling point | 515.8±50.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | Benzyl-1-thio-α-D-mannopyranoside |
---|---|
CAS | 74590-47-9 |
Formula | C13 H18 O5 S |
MW | 286.34 |
Boiling point | 515.8±50.0 °C(Predicted) |
CAS | 74590-47-9 |
---|---|
Formula | C13 H18 O5 S |
MW | 286.34 |
Boiling point | 515.8±50.0 °C(Predicted) |
Smiles | S(CC1=CC=CC=C1)[C@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@@H]1O |
InchiKey | DFHLGNPEEWMYFO-NAWOPXAZSA-N |