Product Name | (2R,3S,4S,5R,6R)-2-(Hydroxymethyl)-6-(2-mercaptoethoxy)tetrahydro-2H-pyran-3,4,5-triol |
---|---|
CAS | 130263-77-3 |
Formula | C8 H16 O6 S |
MW | 240.27 |
MDL | MFCD09840866 |
Boiling point | 459.6±45.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | (2R,3S,4S,5R,6R)-2-(Hydroxymethyl)-6-(2-mercaptoethoxy)tetrahydro-2H-pyran-3,4,5-triol |
---|---|
CAS | 130263-77-3 |
Formula | C8 H16 O6 S |
MW | 240.27 |
MDL | MFCD09840866 |
Boiling point | 459.6±45.0 °C(Predicted) |
CAS | 130263-77-3 |
---|---|
Formula | C8 H16 O6 S |
MW | 240.27 |
MDL | MFCD09840866 |
Boiling point | 459.6±45.0 °C(Predicted) |
Smiles | SCCO[C@@H]1OC(CO)[C@H](C([C@@H]1O)O)O |
InchiKey | HUYFGRHVKQZODJ-OAIINSLMSA-N |