| Product Name | 4-Pyridoxic acid | 
|---|---|
| CAS | 82-82-6 | 
| Formula | C8H9NO4 | 
| MW | 183.16 | 
| Appearance | Pale Beige to Light Brown Solid | 
| MDL | MFCD00006334 | 
| Melting point | 258-261 °C (dec.) (lit.) | 
| Boiling point | 584.5±50.0 °C(Predicted) | 
| Storage condition | -20°C | 
                    Product Center
                
                                        
                                    
                                    
                                        MF:
C8H9NO4                                        
                                    
                                    
                                        MW:
183.16                                        
                                    
                            Characters:Pale Beige to Light Brown Solid
                        | Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB124762 | yunbang | 25mg | 98% | $64.17 | Visible after login | Inquiry | ||
| YB124762 | yunbang | 100mg | 98% | $106.67 | Visible after login | Inquiry | ||
| YB124762 | yunbang | 100mg | 97% | $124.17 | Visible after login | In stock | ||
| YB124762 | yunbang | 250mg | 97% | $185.00 | Visible after login | In stock | ||
| YB124762 | yunbang | 1g | 97% | $463.33 | Visible after login | In stock | 
| Product Name | 4-Pyridoxic acid | 
|---|---|
| CAS | 82-82-6 | 
| Formula | C8H9NO4 | 
| MW | 183.16 | 
| Appearance | Pale Beige to Light Brown Solid | 
| MDL | MFCD00006334 | 
| Melting point | 258-261 °C (dec.) (lit.) | 
| Boiling point | 584.5±50.0 °C(Predicted) | 
| Storage condition | -20°C | 
| CAS | 82-82-6 | 
|---|---|
| Formula | C8H9NO4 | 
| MW | 183.16 | 
| Appearance | Pale Beige to Light Brown Solid | 
| MDL | MFCD00006334 | 
| Melting point | 258-261 °C (dec.) (lit.) | 
| Boiling point | 584.5±50.0 °C(Predicted) | 
| Storage | -20°C | 
| Smiles | C1(C(O)=C(C(=O)O)C(CO)=CN=1)C | 
| InchiKey | HXACOUQIXZGNBF-UHFFFAOYSA-N |