Product Name | 8-Methoxycarbonyloctanoyl2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside |
---|---|
CAS | 104494-93-1 |
Formula | C24 H36 O13 |
MW | 532.53 |
MDL | MFCD09750789 |
Boiling point | 549.2±50.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 8-Methoxycarbonyloctanoyl2,3,4,6-tetra-O-acetyl-b-D-galactopyranoside |
---|---|
CAS | 104494-93-1 |
Formula | C24 H36 O13 |
MW | 532.53 |
MDL | MFCD09750789 |
Boiling point | 549.2±50.0 °C(Predicted) |
CAS | 104494-93-1 |
---|---|
Formula | C24 H36 O13 |
MW | 532.53 |
MDL | MFCD09750789 |
Boiling point | 549.2±50.0 °C(Predicted) |
Smiles | [C@H]1(OC(C)=O)[C@H](OC(CCCCCCCC(OC)=O)=O)O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |&1:0,5,21,27,32,r| |
InchiKey | OEKGNKBFJPVGPL-ZBOVPGFBNA-N |