Product Name | 4-Nitrophenyl 2,3,4-tri-O-acetyl -β-D-xylopyranoside |
---|---|
CAS | 24624-78-0 |
Formula | C17 H19 N O10 |
MW | 397.33 |
MDL | MFCD08703871 |
Melting point | 138-140 °C |
Boiling point | 501.6±50.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 4-Nitrophenyl 2,3,4-tri-O-acetyl -β-D-xylopyranoside |
---|---|
CAS | 24624-78-0 |
Formula | C17 H19 N O10 |
MW | 397.33 |
MDL | MFCD08703871 |
Melting point | 138-140 °C |
Boiling point | 501.6±50.0 °C(Predicted) |
CAS | 24624-78-0 |
---|---|
Formula | C17 H19 N O10 |
MW | 397.33 |
MDL | MFCD08703871 |
Melting point | 138-140 °C |
Boiling point | 501.6±50.0 °C(Predicted) |
Smiles | [C@H]1(OC(C)=O)[C@H](OC2C=CC(=CC=2)[N+](=O)[O-])OC[C@@H](OC(C)=O)[C@@H]1OC(C)=O |&1:0,5,18,23,r| |
InchiKey | RHQVDBUKWZSUQM-LJJCISQENA-N |