Product Name | Methyl2-acetamido-4,6-O-benzylidene-2-deoxy-b-D-glucopyranoside |
---|---|
CAS | 10300-76-2 |
Formula | C16 H21 N O6 |
MW | 323.341 |
MDL | MFCD04039590 |
Melting point | 296-298 °C |
Boiling point | 579.4±50.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | Methyl2-acetamido-4,6-O-benzylidene-2-deoxy-b-D-glucopyranoside |
---|---|
CAS | 10300-76-2 |
Formula | C16 H21 N O6 |
MW | 323.341 |
MDL | MFCD04039590 |
Melting point | 296-298 °C |
Boiling point | 579.4±50.0 °C(Predicted) |
CAS | 10300-76-2 |
---|---|
Formula | C16 H21 N O6 |
MW | 323.341 |
MDL | MFCD04039590 |
Melting point | 296-298 °C |
Boiling point | 579.4±50.0 °C(Predicted) |
Smiles | [C@@]12([H])OC(OC[C@@]1([H])O[C@@H](OC)[C@H](NC(=O)C)[C@H]2O)C1=CC=CC=C1 |&1:0,6,9,12,17,r| |
InchiKey | XCDVOAZVARITEI-ZCCIRLMGNA-N |