Product Name | Methyl-4,6-di-O-benzylidene-2,3-di-O-benzyl-α-D-glucopyranoside |
---|---|
CAS | 13225-19-9 |
Formula | C28 H30 O6 |
MW | 462.53 |
MDL | MFCD04973354 |
Melting point | 93 °C(Solv: ethanol (64-17-5); water (7732-18-5)) |
Boiling point | 585.4±50.0 °C(Predicted) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | Methyl-4,6-di-O-benzylidene-2,3-di-O-benzyl-α-D-glucopyranoside |
---|---|
CAS | 13225-19-9 |
Formula | C28 H30 O6 |
MW | 462.53 |
MDL | MFCD04973354 |
Melting point | 93 °C(Solv: ethanol (64-17-5); water (7732-18-5)) |
Boiling point | 585.4±50.0 °C(Predicted) |
CAS | 13225-19-9 |
---|---|
Formula | C28 H30 O6 |
MW | 462.53 |
MDL | MFCD04973354 |
Melting point | 93 °C(Solv: ethanol (64-17-5); water (7732-18-5)) |
Boiling point | 585.4±50.0 °C(Predicted) |
Smiles | O(C)[C@H]1O[C@@H]2COC(O[C@H]2[C@H](OCC2=CC=CC=C2)[C@H]1OCC1=CC=CC=C1)C1=CC=CC=C1 |
InchiKey | CVHUOBYFXKHVJR-GUONBBAESA-N |