| Product Name | 1,1,1,3,3,3-Hexafluoroisopropyl methacrylate |
|---|---|
| Chinese alias | HFiPMA |
| CAS | 3063-94-3 |
| Formula | C7H6F6O2 |
| MW | 236.11 |
| Appearance | Clear colorless liquid |
| MDL | MFCD00040105 |
| Boiling point | 99 °C |
| Storage condition | Flammables area |
Product Center
MF:
C7H6F6O2
MW:
236.11
Characters:Clear colorless liquid
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB38059 | yunbang | 1g | 98% (stabilized with MEHQ) | $9.17 | Visible after login | Inquiry | ||
| YB38059 | yunbang | 5g | 98% (stabilized with MEHQ) | $23.33 | Visible after login | Inquiry | ||
| YB38059 | yunbang | 25g | 98% (stabilized with MEHQ) | $81.67 | Visible after login | Inquiry |
| Product Name | 1,1,1,3,3,3-Hexafluoroisopropyl methacrylate |
|---|---|
| Chinese alias | HFiPMA |
| CAS | 3063-94-3 |
| Formula | C7H6F6O2 |
| MW | 236.11 |
| Appearance | Clear colorless liquid |
| MDL | MFCD00040105 |
| Boiling point | 99 °C |
| Storage condition | Flammables area |
| Symbol | N/A |
|---|---|
| Safe Property | S16-26-33-36 |
| Hazard Category Code | R11-20/21/22-36/37/38 |
| Chinese alias | HFiPMA |
|---|---|
| CAS | 3063-94-3 |
| Formula | C7H6F6O2 |
| MW | 236.11 |
| Appearance | Clear colorless liquid |
| MDL | MFCD00040105 |
| Boiling point | 99 °C |
| Safe Property | S16-26-33-36 |
| Hazard Category Code | R11-20/21/22-36/37/38 |
| Storage | Flammables area |
| Smiles | C(C(F)(F)F)(C(F)(F)F)OC(=O)C(=C)C |
| InchiKey | FMQPBWHSNCRVQJ-UHFFFAOYSA-N |