| Product Name | Prednisolone disodium phosphate |
|---|---|
| Chinese alias | Prednisolone 21-phosphate disodium salt |
| CAS | 125-02-0 |
| Formula | C21H29O8P.2Na |
| MW | 484.39 |
| MDL | MFCD00083682 |
| Melting point | 100 °C |
| Boiling point | 674.8 ºC at 760 mmHg |
Product Center
MF:
C21H29O8P.2Na
MW:
484.39
Characters:
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB41085 | yunbang | 1g | 98% | $48.33 | Visible after login | Inquiry | ||
| YB41085 | yunbang | 5g | 98% | $166.67 | Visible after login | Inquiry | ||
| YB41085 | yunbang | 25g | 98% | $513.33 | Visible after login | Inquiry |
| Product Name | Prednisolone disodium phosphate |
|---|---|
| Chinese alias | Prednisolone 21-phosphate disodium salt |
| CAS | 125-02-0 |
| Formula | C21H29O8P.2Na |
| MW | 484.39 |
| MDL | MFCD00083682 |
| Melting point | 100 °C |
| Boiling point | 674.8 ºC at 760 mmHg |
| Symbol | N/A |
|---|---|
| Safe Property | S26-S36 |
| Hazard Category Code | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . R36/37/38:Irritating to eyes, respiratory system and skin . |
| Chinese alias | Prednisolone 21-phosphate disodium salt |
|---|---|
| CAS | 125-02-0 |
| Formula | C21H29O8P.2Na |
| MW | 484.39 |
| MDL | MFCD00083682 |
| Melting point | 100 °C |
| Boiling point | 674.8 ºC at 760 mmHg |
| Safe Property | S26-S36 |
| Hazard Category Code | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed . R36/37/38:Irritating to eyes, respiratory system and skin . |
| Smiles | C[C@@]12[C@@](O)(C(=O)COP(O)(O)=O)CC[C@@]1([H])[C@]1([H])CCC3=CC(C=C[C@]3(C)[C@@]1([H])[C@H](C2)O)=O.[Na] |^1:33| |
| InchiKey | FZSZNUSQBKSTHL-WDCKKOMHSA-N |