Product Name | Cyclohexyl anthranilate |
---|---|
CAS | 7779-16-0 |
Formula | C13H17NO2 |
MW | 219.29 |
Appearance | Viscous yellow liquid |
MDL | MFCD00036492 |
Boiling point | 134 °C |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | Cyclohexyl anthranilate |
---|---|
CAS | 7779-16-0 |
Formula | C13H17NO2 |
MW | 219.29 |
Appearance | Viscous yellow liquid |
MDL | MFCD00036492 |
Boiling point | 134 °C |
CAS | 7779-16-0 |
---|---|
Formula | C13H17NO2 |
MW | 219.29 |
Appearance | Viscous yellow liquid |
MDL | MFCD00036492 |
Boiling point | 134 °C |
Smiles | NC1C(C(=O)OC2CCCCC2)=CC=CC=1 |
InchiKey | KFEZETDKFSMLMG-UHFFFAOYSA-N |