| Chinese alias | 1-(2-Methylpropyl)-1H-imidazole[4,5-c]quinoline-4-amine, Imiquimod - CAS 99011-02-6 - Calbiochem |
| CAS | 99011-02-6 |
| Formula | C14H16N4 |
| MW | 240.3 |
| Appearance | white solid |
| MDL | MFCD00866946 |
| Melting point | 292-294 °C |
| Boiling point | 292-294°C |
| Chemical Stability | Incompatible with strong oxidizing agents. |
| Safe Property | S26-S45 |
| Hazard Category Code | R25;R36/37/38 |
| Water Solubility | DMSO: 3 mg/mL |
| Storage | OK to freezeprotect from light 2-8°C |
| Smiles | C(N1C=NC2C(N)=NC3=CC=CC=C3C1=2)C(C)C |
| InchiKey | DOUYETYNHWVLEO-UHFFFAOYSA-N |