| Chinese alias | Adenosine Deaminase Inhibitor, DCF - CAS 53910-25-1 - Calbiochem, 2ʹ-Deoxycoformycin, (8R)-3-(2-deox |
| CAS | 53910-25-1 |
| Formula | C11H16N4O4 |
| MW | 268.27 |
| Appearance | white solid |
| MDL | MFCD00871281 |
| Melting point | 220-225 °C |
| Boiling point | 220-225ºC |
| Chemical Stability | Commercially available pentostatin powder for injection should be stored at 2-8 °C. ... When stored |
| Hazard Category Code | 22 |
| Water Solubility | DMSO: 10 mg/mL, clear, colorlesswater: 50 mg/mL, clear, colorless |
| Storage | OK to freezeprotect from light 2-8°C |
| Smiles | O[C@@H]1CN=CNC2N([C@@]3([H])C[C@H](O)[C@@H](CO)O3)C=NC1=2 |
| InchiKey | FPVKHBSQESCIEP-JQCXWYLXSA-N |