| Product Name | L-Glutamic acid γ-(4-nitroanilide) |
|---|---|
| CAS | 7300-59-6 |
| Formula | C11 H13 N3 O5 |
| MW | 267.24 |
| Appearance | White to Pale Yellow Solid |
| MDL | MFCD00036218 |
| Melting point | 185-188°C |
| Boiling point | 590.6±50.0 °C(Predicted) |
| Storage condition | 2-8°C |
Product Center
MF:
C11 H13 N3 O5
MW:
267.24
Characters:White to Pale Yellow Solid
| Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
|---|---|---|---|---|---|---|---|---|
| YB552143 | yunbang | 1g | 98%(HPLC)(T) | $75.83 | Visible after login | In stock | ||
| YB552143 | yunbang | 5g | 98%(HPLC)(T) | $286.66 | Visible after login | In stock | ||
| YB552143 | yunbang | 25g | 98%(HPLC)(T) | $1035.00 | Visible after login | In stock |
| Product Name | L-Glutamic acid γ-(4-nitroanilide) |
|---|---|
| CAS | 7300-59-6 |
| Formula | C11 H13 N3 O5 |
| MW | 267.24 |
| Appearance | White to Pale Yellow Solid |
| MDL | MFCD00036218 |
| Melting point | 185-188°C |
| Boiling point | 590.6±50.0 °C(Predicted) |
| Storage condition | 2-8°C |
| Symbol | N/A |
|---|---|
| Safe Property | 22-24/25 |
| 物编码 | 2026-06-09 17:02:59 |
| CAS | 7300-59-6 |
|---|---|
| Formula | C11 H13 N3 O5 |
| MW | 267.24 |
| Appearance | White to Pale Yellow Solid |
| MDL | MFCD00036218 |
| Melting point | 185-188°C |
| Boiling point | 590.6±50.0 °C(Predicted) |
| Safe Property | 22-24/25 |
| Storage | 2-8°C |
| Smiles | C([C@@H](NC1C=CC([N+](=O)[O-])=CC=1)CCC(=O)N)(=O)O |
| InchiKey | IMTMBDXEKMXETQ-VIFPVBQESA-N |