Product Name | 1,2,4,6-O-Tetraacetyl-beta-D-glucose |
---|---|
CAS | 27086-14-2 |
Formula | C14 H20 O10 |
MW | 348.30 |
MDL | MFCD34181423 |
Melting point | 127 °C(lit.) |
Boiling point | 458.5±45.0 °C(lit.) |
Art.No. | Brand | Size | Purity/Grade | Price(USD) | VIP Price (USD) | Availability | Quantity | |
---|---|---|---|---|---|---|---|---|
There is no price information at the moment, you can send an inquiry,and we will reply to you as soon as possible. |
Product Name | 1,2,4,6-O-Tetraacetyl-beta-D-glucose |
---|---|
CAS | 27086-14-2 |
Formula | C14 H20 O10 |
MW | 348.30 |
MDL | MFCD34181423 |
Melting point | 127 °C(lit.) |
Boiling point | 458.5±45.0 °C(lit.) |
CAS | 27086-14-2 |
---|---|
Formula | C14 H20 O10 |
MW | 348.30 |
MDL | MFCD34181423 |
Melting point | 127 °C(lit.) |
Boiling point | 458.5±45.0 °C(lit.) |
特性 | * |
Smiles | C1(C(OC(C)=O)C(O)C(OC(C)=O)C(COC(C)=O)O1)OC(C)=O |
InchiKey | VEXTUPCIMUQWAO-UHFFFAOYSA-N |